C43H42N6O4S2 — CID 68997249
2-[1-(benzenesulfonyl)indol-4-yl]-1-(2-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindol-1-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 68997249) has the molecular formula C43H42N6O4S2 and a molecular weight of 770.98 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)indol-4-yl]-1-(2-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindol-1-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[1-(benzenesulfonyl)indol-4-yl]-1-(2-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindol-1-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 68997249 |
| Molecular Formula | C43H42N6O4S2 |
| Molecular Weight | 770.98 g/mol |
| Exact Mass | 770.27 |
| IUPAC Name | 2-[1-(benzenesulfonyl)indol-4-yl]-1-(2-naphthalen-2-ylsulfonyl-4-piperazin-1-ylindol-1-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)c1cc2c(N3CCNCC3)cccc2n1C1C2CCCN2CCN1c1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C43H42N6O4S2/c50-54(51,34-19-18-31-9-4-5-10-32(31)29-34)42-30-36-37(46-25-21-44-22-26-46)13-6-16-40(36)49(42)43-41-17-8-23-45(41)27-28-47(43)38-14-7-15-39-35(38)20-24-48(39)55(52,53)33-11-2-1-3-12-33/h1-7,9-16,18-20,24,29-30,41,43-44H,8,17,21-23,25-28H2 |
| InChIKey | MEBKGPXADMALKK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |