C11H16O2 — CID 68997394
2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl acetate (PubChem CID 68997394) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl acetate.
| Compound Name | 2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl acetate |
|---|---|
| PubChem CID | 68997394 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl acetate |
| SMILES | CC(=O)OC1C=CC2CCCC2C1 |
| InChI | InChI=1S/C11H16O2/c1-8(12)13-11-6-5-9-3-2-4-10(9)7-11/h5-6,9-11H,2-4,7H2,1H3 |
| InChIKey | YZOQYYNGYBPTGF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|