About bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate
bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (PubChem CID 68997709) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| PubChem CID | 68997709 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| SMILES | C1=CC2CCC1C2.COC(=O)C1=CC2CCC1C2 |
| InChI | InChI=1S/C9H12O2.C7H10/c1-11-9(10)8-5-6-2-3-7(8)4-6;1-2-7-4-3-6(1)5-7/h5-7H,2-4H2,1H3;1-2,6-7H,3-5H2 |
| InChIKey | JAUXXOOFULZLCL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (CID 68997709) is bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate is C1=CC2CCC1C2.COC(=O)C1=CC2CCC1C2.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The InChIKey is JAUXXOOFULZLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C7H10/c1-11-9(10)8-5-6-2-3-7(8)4-6;1-2-7-4-3-6(1)5-7/h5-7H,2-4H2,1H3;1-2,6-7H,3-5H2.
What are the key properties of bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate has a molecular weight of 246.35 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;methyl bicyclo[2.2.1]hept-2-ene-2-carboxylate is sourced from PubChem (CID 68997709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).