About 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline
6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline (PubChem CID 68998740) has the molecular formula C19H18N2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline.
Molecular Properties
| Compound Name | 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline |
| PubChem CID | 68998740 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline |
| SMILES | CN1Cc2ccccc2C(c2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C19H18N2/c1-21-12-16-5-2-3-7-17(16)18(13-21)14-8-9-19-15(11-14)6-4-10-20-19/h2-11,18H,12-13H2,1H3 |
| InChIKey | WXJVSDNWZOTTOK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline?
The IUPAC name of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline (CID 68998740) is 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline.
What is the SMILES notation for 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline?
The canonical SMILES for 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline is CN1Cc2ccccc2C(c2ccc3ncccc3c2)C1.
What is the InChIKey of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline?
The InChIKey is WXJVSDNWZOTTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2/c1-21-12-16-5-2-3-7-17(16)18(13-21)14-8-9-19-15(11-14)6-4-10-20-19/h2-11,18H,12-13H2,1H3.
What are the key properties of 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline?
6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline has a molecular weight of 274.37 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoline is sourced from PubChem (CID 68998740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).