C15H21BrN4O2Si — CID 68999347
3-(3-bromophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 68999347) has the molecular formula C15H21BrN4O2Si and a molecular weight of 397.35 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-(3-bromophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 68999347 |
| Molecular Formula | C15H21BrN4O2Si |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 3-(3-bromophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | C[Si](C)(C)CCOCNC(=O)c1nc(-c2cccc(Br)c2)n[nH]1 |
| InChI | InChI=1S/C15H21BrN4O2Si/c1-23(2,3)8-7-22-10-17-15(21)14-18-13(19-20-14)11-5-4-6-12(16)9-11/h4-6,9H,7-8,10H2,1-3H3,(H,17,21)(H,18,19,20) |
| InChIKey | FEGJVBGFXKTYCU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|