C30H50O12 — CID 68999439
[(2R,3S,4S,5R)-6-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (Z)-octadec-9-enoate (PubChem CID 68999439) has the molecular formula C30H50O12 and a molecular weight of 602.72 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-6-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,4S,5R)-6-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 68999439 |
| Molecular Formula | C30H50O12 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | [(2R,3S,4S,5R)-6-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]1OC(OC2=C(O)[C@@H]([C@@H](O)CO)OC2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H50O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(33)39-19-21-23(34)24(35)25(36)30(40-21)42-28-26(37)27(20(32)18-31)41-29(28)38/h9-10,20-21,23-25,27,30-32,34-37H,2-8,11-19H2,1H3/b10-9-/t20-,21+,23+,24-,25+,27+,30?/m0/s1 |
| InChIKey | NSETYTYUKLIXOS-IFTKHLBUSA-N |
| XLogP | 2.44 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|