C26H36Cl2N4 — CID 68999696
11-benzyl-6,7-dichloro-4-methyl-7-phenyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane (PubChem CID 68999696) has the molecular formula C26H36Cl2N4 and a molecular weight of 475.51 g/mol. Its IUPAC name is 11-benzyl-6,7-dichloro-4-methyl-7-phenyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane.
| Compound Name | 11-benzyl-6,7-dichloro-4-methyl-7-phenyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
|---|---|
| PubChem CID | 68999696 |
| Molecular Formula | C26H36Cl2N4 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 11-benzyl-6,7-dichloro-4-methyl-7-phenyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
| SMILES | CN1CCN2CCCN(Cc3ccccc3)CCN(CC2)C(Cl)(c2ccccc2)C(Cl)C1 |
| InChI | InChI=1S/C26H36Cl2N4/c1-29-15-16-30-13-8-14-31(21-23-9-4-2-5-10-23)18-20-32(19-17-30)26(28,25(27)22-29)24-11-6-3-7-12-24/h2-7,9-12,25H,8,13-22H2,1H3 |
| InChIKey | IEOWHYYAEWZKPL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|