C19H17N3O5S — CID 68999729
[4-[[6-[(4-methylphenyl)sulfonylamino]-3-pyridinyl]oxy]phenyl]carbamic acid (PubChem CID 68999729) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is [4-[[6-[(4-methylphenyl)sulfonylamino]-3-pyridinyl]oxy]phenyl]carbamic acid.
| Compound Name | [4-[[6-[(4-methylphenyl)sulfonylamino]-3-pyridinyl]oxy]phenyl]carbamic acid |
|---|---|
| PubChem CID | 68999729 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [4-[[6-[(4-methylphenyl)sulfonylamino]-3-pyridinyl]oxy]phenyl]carbamic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Oc3ccc(NC(=O)O)cc3)cn2)cc1 |
| InChI | InChI=1S/C19H17N3O5S/c1-13-2-9-17(10-3-13)28(25,26)22-18-11-8-16(12-20-18)27-15-6-4-14(5-7-15)21-19(23)24/h2-12,21H,1H3,(H,20,22)(H,23,24) |
| InChIKey | MZPSNFBJFXFMMT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |