C26H26Cl2O5 — CID 68999886
5-[4-(2,6-dichloro-4-phenylmethoxyphenoxy)butoxy]-2,2-dimethyl-1,3-benzodioxole (PubChem CID 68999886) has the molecular formula C26H26Cl2O5 and a molecular weight of 489.40 g/mol. Its IUPAC name is 5-[4-(2,6-dichloro-4-phenylmethoxyphenoxy)butoxy]-2,2-dimethyl-1,3-benzodioxole.
| Compound Name | 5-[4-(2,6-dichloro-4-phenylmethoxyphenoxy)butoxy]-2,2-dimethyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 68999886 |
| Molecular Formula | C26H26Cl2O5 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 5-[4-(2,6-dichloro-4-phenylmethoxyphenoxy)butoxy]-2,2-dimethyl-1,3-benzodioxole |
| SMILES | CC1(C)Oc2ccc(OCCCCOc3c(Cl)cc(OCc4ccccc4)cc3Cl)cc2O1 |
| InChI | InChI=1S/C26H26Cl2O5/c1-26(2)32-23-11-10-19(16-24(23)33-26)29-12-6-7-13-30-25-21(27)14-20(15-22(25)28)31-17-18-8-4-3-5-9-18/h3-5,8-11,14-16H,6-7,12-13,17H2,1-2H3 |
| InChIKey | FTAVCYOWBTTYET-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|