About 5-bromo-2-fluoropyridine
5-bromo-2-fluoropyridine (PubChem CID 69000172) has the molecular formula C10H6Br2F2N2
and a molecular weight of 351.98 g/mol. Its IUPAC name is 5-bromo-2-fluoropyridine.
Molecular Properties
| Compound Name | 5-bromo-2-fluoropyridine |
| PubChem CID | 69000172 |
| Molecular Formula | C10H6Br2F2N2 |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 349.89 |
| IUPAC Name | 5-bromo-2-fluoropyridine |
| SMILES | Fc1ccc(Br)cn1.Fc1ccc(Br)cn1 |
| InChI | InChI=1S/2C5H3BrFN/c2*6-4-1-2-5(7)8-3-4/h2*1-3H |
| InChIKey | ZXYNQNULZBJPMA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-fluoropyridine?
The IUPAC name of 5-bromo-2-fluoropyridine (CID 69000172) is 5-bromo-2-fluoropyridine.
What is the SMILES notation for 5-bromo-2-fluoropyridine?
The canonical SMILES for 5-bromo-2-fluoropyridine is Fc1ccc(Br)cn1.Fc1ccc(Br)cn1.
What is the InChIKey of 5-bromo-2-fluoropyridine?
The InChIKey is ZXYNQNULZBJPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H3BrFN/c2*6-4-1-2-5(7)8-3-4/h2*1-3H.
What are the key properties of 5-bromo-2-fluoropyridine?
5-bromo-2-fluoropyridine has a molecular weight of 351.98 g/mol, XLogP of 3.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-fluoropyridine is sourced from PubChem (CID 69000172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).