C27H20N4O — CID 6900050
N-[(E)-anthracen-9-ylmethylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide (PubChem CID 6900050) has the molecular formula C27H20N4O and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 6900050 |
| Molecular Formula | C27H20N4O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1c2ccccc2cc2ccccc12)c1[nH]nc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C27H20N4O/c32-27(26-23-14-13-17-7-1-6-12-22(17)25(23)29-30-26)31-28-16-24-20-10-4-2-8-18(20)15-19-9-3-5-11-21(19)24/h1-12,15-16H,13-14H2,(H,29,30)(H,31,32)/b28-16+ |
| InChIKey | QYSJSIRKFILNOR-LQKURTRISA-N |
| XLogP | 5.25 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|