About 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline
4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline (PubChem CID 6900072) has the molecular formula C16H16N4
and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline |
| PubChem CID | 6900072 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/n2ncc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16N4/c1-19(2)15-9-7-13(8-10-15)11-17-20-16-6-4-3-5-14(16)12-18-20/h3-12H,1-2H3/b17-11+ |
| InChIKey | UNZHITZXBPGMBR-GZTJUZNOSA-N |
| XLogP | 2.98 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline?
The IUPAC name of 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline (CID 6900072) is 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline is CN(C)c1ccc(/C=N/n2ncc3ccccc32)cc1.
What is the InChIKey of 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline?
The InChIKey is UNZHITZXBPGMBR-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H16N4/c1-19(2)15-9-7-13(8-10-15)11-17-20-16-6-4-3-5-14(16)12-18-20/h3-12H,1-2H3/b17-11+.
What are the key properties of 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline?
4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline has a molecular weight of 264.33 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-indazol-1-yliminomethyl]-N,N-dimethylaniline is sourced from PubChem (CID 6900072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).