About dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate
dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate (PubChem CID 69000787) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate |
| PubChem CID | 69000787 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate |
| SMILES | CC(C)OC(=O)C1(C(=O)OC(C)C)CC(O)C1 |
| InChI | InChI=1S/C12H20O5/c1-7(2)16-10(14)12(5-9(13)6-12)11(15)17-8(3)4/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | KGJGEGCBWIXNRP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate?
The IUPAC name of dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate (CID 69000787) is dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate.
What is the SMILES notation for dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate?
The canonical SMILES for dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate is CC(C)OC(=O)C1(C(=O)OC(C)C)CC(O)C1.
What is the InChIKey of dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate?
The InChIKey is KGJGEGCBWIXNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5/c1-7(2)16-10(14)12(5-9(13)6-12)11(15)17-8(3)4/h7-9,13H,5-6H2,1-4H3.
What are the key properties of dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate?
dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate has a molecular weight of 244.29 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl 3-hydroxycyclobutane-1,1-dicarboxylate is sourced from PubChem (CID 69000787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).