C39H49NO10 — CID 69000981
2-[3-[3-(3,4-dimethoxyphenyl)-1-[1-[1-[2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl]ethenoxy]propyl]phenoxy]acetic acid (PubChem CID 69000981) has the molecular formula C39H49NO10 and a molecular weight of 691.82 g/mol. Its IUPAC name is 2-[3-[3-(3,4-dimethoxyphenyl)-1-[1-[1-[2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl]ethenoxy]propyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-(3,4-dimethoxyphenyl)-1-[1-[1-[2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl]ethenoxy]propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 69000981 |
| Molecular Formula | C39H49NO10 |
| Molecular Weight | 691.82 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 2-[3-[3-(3,4-dimethoxyphenyl)-1-[1-[1-[2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl]ethenoxy]propyl]phenoxy]acetic acid |
| SMILES | C=C(OC(CCc1ccc(OC)c(OC)c1)c1cccc(OCC(=O)O)c1)C1CCCCN1C(=O)C(CC)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C39H49NO10/c1-8-30(28-22-35(46-5)38(48-7)36(23-28)47-6)39(43)40-19-10-9-14-31(40)25(2)50-32(27-12-11-13-29(21-27)49-24-37(41)42)17-15-26-16-18-33(44-3)34(20-26)45-4/h11-13,16,18,20-23,30-32H,2,8-10,14-15,17,19,24H2,1,3-7H3,(H,41,42) |
| InChIKey | BQGLHPJSVCMAGB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|