About 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid
2-methyl-3-(1,3-oxathian-4-yl)propanoic acid (PubChem CID 69001107) has the molecular formula C8H14O3S
and a molecular weight of 190.26 g/mol. Its IUPAC name is 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid |
| PubChem CID | 69001107 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid |
| SMILES | CC(CC1CCOCS1)C(=O)O |
| InChI | InChI=1S/C8H14O3S/c1-6(8(9)10)4-7-2-3-11-5-12-7/h6-7H,2-5H2,1H3,(H,9,10) |
| InChIKey | WPHXQRGUDSZCHA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid?
The IUPAC name of 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid (CID 69001107) is 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid.
What is the SMILES notation for 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid?
The canonical SMILES for 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid is CC(CC1CCOCS1)C(=O)O.
What is the InChIKey of 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid?
The InChIKey is WPHXQRGUDSZCHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3S/c1-6(8(9)10)4-7-2-3-11-5-12-7/h6-7H,2-5H2,1H3,(H,9,10).
What are the key properties of 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid?
2-methyl-3-(1,3-oxathian-4-yl)propanoic acid has a molecular weight of 190.26 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1,3-oxathian-4-yl)propanoic acid is sourced from PubChem (CID 69001107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).