C20H18N4O5 — CID 6900111
(2E,6R)-2-benzylidene-6-[(Z)-[(3,5-dinitrophenyl)hydrazinylidene]methyl]cyclohexan-1-one (PubChem CID 6900111) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is (2E,6R)-2-benzylidene-6-[(Z)-[(3,5-dinitrophenyl)hydrazinylidene]methyl]cyclohexan-1-one.
| Compound Name | (2E,6R)-2-benzylidene-6-[(Z)-[(3,5-dinitrophenyl)hydrazinylidene]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 6900111 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (2E,6R)-2-benzylidene-6-[(Z)-[(3,5-dinitrophenyl)hydrazinylidene]methyl]cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccccc2)CCC[C@@H]1/C=N\Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N4O5/c25-20-15(9-14-5-2-1-3-6-14)7-4-8-16(20)13-21-22-17-10-18(23(26)27)12-19(11-17)24(28)29/h1-3,5-6,9-13,16,22H,4,7-8H2/b15-9+,21-13-/t16-/m1/s1 |
| InChIKey | CGRCZJMHOQTISU-GVIQGRKQSA-N |
| XLogP | 4.35 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|