About tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid
tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid (PubChem CID 69001434) has the molecular formula C16H20F2N2O2
and a molecular weight of 310.34 g/mol. Its IUPAC name is tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid |
| PubChem CID | 69001434 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1C2CN(c3ccc(F)cc3F)CC21 |
| InChI | InChI=1S/C16H20F2N2O2/c1-16(2,3)20(15(21)22)14-10-7-19(8-11(10)14)13-5-4-9(17)6-12(13)18/h4-6,10-11,14H,7-8H2,1-3H3,(H,21,22) |
| InChIKey | SRBTTWMDCIUVLQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid?
The IUPAC name of tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid (CID 69001434) is tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid.
What is the SMILES notation for tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid?
The canonical SMILES for tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid is CC(C)(C)N(C(=O)O)C1C2CN(c3ccc(F)cc3F)CC21.
What is the InChIKey of tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid?
The InChIKey is SRBTTWMDCIUVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2N2O2/c1-16(2,3)20(15(21)22)14-10-7-19(8-11(10)14)13-5-4-9(17)6-12(13)18/h4-6,10-11,14H,7-8H2,1-3H3,(H,21,22).
What are the key properties of tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid?
tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid has a molecular weight of 310.34 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[3-(2,4-difluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamic acid is sourced from PubChem (CID 69001434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).