About [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate
[(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate (PubChem CID 6900152) has the molecular formula C11H7N3O3S
and a molecular weight of 261.26 g/mol. Its IUPAC name is [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate.
Molecular Properties
| Compound Name | [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate |
| PubChem CID | 6900152 |
| Molecular Formula | C11H7N3O3S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate |
| SMILES | Cc1csc(/C(C#N)=N/OC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C11H7N3O3S/c1-7-6-18-10(13-7)8(5-12)14-17-11(15)9-3-2-4-16-9/h2-4,6H,1H3/b14-8+ |
| InChIKey | RRIBYOCICZAVPU-RIYZIHGNSA-N |
| XLogP | 2.13 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate?
The IUPAC name of [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate (CID 6900152) is [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate.
What is the SMILES notation for [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate?
The canonical SMILES for [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate is Cc1csc(/C(C#N)=N/OC(=O)c2ccco2)n1.
What is the InChIKey of [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate?
The InChIKey is RRIBYOCICZAVPU-RIYZIHGNSA-N. The full InChI is InChI=1S/C11H7N3O3S/c1-7-6-18-10(13-7)8(5-12)14-17-11(15)9-3-2-4-16-9/h2-4,6H,1H3/b14-8+.
What are the key properties of [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate?
[(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate has a molecular weight of 261.26 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] furan-2-carboxylate is sourced from PubChem (CID 6900152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).