About (2R)-2-hydroxy-2-phenylacetic acid;hydrate
(2R)-2-hydroxy-2-phenylacetic acid;hydrate (PubChem CID 69001631) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-phenylacetic acid;hydrate.
Molecular Properties
| Compound Name | (2R)-2-hydroxy-2-phenylacetic acid;hydrate |
| PubChem CID | 69001631 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (2R)-2-hydroxy-2-phenylacetic acid;hydrate |
| SMILES | O.O=C(O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H8O3.H2O/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7,9H,(H,10,11);1H2/t7-;/m1./s1 |
| InChIKey | CNDXWMWBOHJYJJ-OGFXRTJISA-N |
| XLogP | -0.02 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-hydroxy-2-phenylacetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxy-2-phenylacetic acid;hydrate?
The IUPAC name of (2R)-2-hydroxy-2-phenylacetic acid;hydrate (CID 69001631) is (2R)-2-hydroxy-2-phenylacetic acid;hydrate.
What is the SMILES notation for (2R)-2-hydroxy-2-phenylacetic acid;hydrate?
The canonical SMILES for (2R)-2-hydroxy-2-phenylacetic acid;hydrate is O.O=C(O)[C@H](O)c1ccccc1.
What is the InChIKey of (2R)-2-hydroxy-2-phenylacetic acid;hydrate?
The InChIKey is CNDXWMWBOHJYJJ-OGFXRTJISA-N. The full InChI is InChI=1S/C8H8O3.H2O/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7,9H,(H,10,11);1H2/t7-;/m1./s1.
What are the key properties of (2R)-2-hydroxy-2-phenylacetic acid;hydrate?
(2R)-2-hydroxy-2-phenylacetic acid;hydrate has a molecular weight of 170.16 g/mol, XLogP of -0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxy-2-phenylacetic acid;hydrate is sourced from PubChem (CID 69001631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).