C15H20BrFN4O2Si — CID 69003055
3-(5-bromo-2-fluorophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 69003055) has the molecular formula C15H20BrFN4O2Si and a molecular weight of 415.34 g/mol. Its IUPAC name is 3-(5-bromo-2-fluorophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-(5-bromo-2-fluorophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 69003055 |
| Molecular Formula | C15H20BrFN4O2Si |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 3-(5-bromo-2-fluorophenyl)-N-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | C[Si](C)(C)CCOCNC(=O)c1nc(-c2cc(Br)ccc2F)n[nH]1 |
| InChI | InChI=1S/C15H20BrFN4O2Si/c1-24(2,3)7-6-23-9-18-15(22)14-19-13(20-21-14)11-8-10(16)4-5-12(11)17/h4-5,8H,6-7,9H2,1-3H3,(H,18,22)(H,19,20,21) |
| InChIKey | SBXIRJJWJIRYSI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|