About 2-[(2,3,4-trifluorophenyl)methylamino]ethanol
2-[(2,3,4-trifluorophenyl)methylamino]ethanol (PubChem CID 69003669) has the molecular formula C9H10F3NO
and a molecular weight of 205.18 g/mol. Its IUPAC name is 2-[(2,3,4-trifluorophenyl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,3,4-trifluorophenyl)methylamino]ethanol |
| PubChem CID | 69003669 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-[(2,3,4-trifluorophenyl)methylamino]ethanol |
| SMILES | OCCNCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H10F3NO/c10-7-2-1-6(5-13-3-4-14)8(11)9(7)12/h1-2,13-14H,3-5H2 |
| InChIKey | FGUFOJVVSFSGGR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,3,4-trifluorophenyl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3,4-trifluorophenyl)methylamino]ethanol?
The IUPAC name of 2-[(2,3,4-trifluorophenyl)methylamino]ethanol (CID 69003669) is 2-[(2,3,4-trifluorophenyl)methylamino]ethanol.
What is the SMILES notation for 2-[(2,3,4-trifluorophenyl)methylamino]ethanol?
The canonical SMILES for 2-[(2,3,4-trifluorophenyl)methylamino]ethanol is OCCNCc1ccc(F)c(F)c1F.
What is the InChIKey of 2-[(2,3,4-trifluorophenyl)methylamino]ethanol?
The InChIKey is FGUFOJVVSFSGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO/c10-7-2-1-6(5-13-3-4-14)8(11)9(7)12/h1-2,13-14H,3-5H2.
What are the key properties of 2-[(2,3,4-trifluorophenyl)methylamino]ethanol?
2-[(2,3,4-trifluorophenyl)methylamino]ethanol has a molecular weight of 205.18 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3,4-trifluorophenyl)methylamino]ethanol is sourced from PubChem (CID 69003669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).