C31H40N6O4 — CID 69003772
1-[3-(dimethylamino)propyl]-3-[(2Z)-2-[[5-methoxy-1-[2-(4-methylpiperazin-1-yl)ethyl]indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]urea (PubChem CID 69003772) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[(2Z)-2-[[5-methoxy-1-[2-(4-methylpiperazin-1-yl)ethyl]indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[(2Z)-2-[[5-methoxy-1-[2-(4-methylpiperazin-1-yl)ethyl]indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]urea |
|---|---|
| PubChem CID | 69003772 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[(2Z)-2-[[5-methoxy-1-[2-(4-methylpiperazin-1-yl)ethyl]indol-3-yl]methylidene]-3-oxo-1-benzofuran-5-yl]urea |
| SMILES | COc1ccc2c(c1)c(/C=C1\Oc3ccc(NC(=O)NCCCN(C)C)cc3C1=O)cn2CCN1CCN(C)CC1 |
| InChI | InChI=1S/C31H40N6O4/c1-34(2)11-5-10-32-31(39)33-23-6-9-28-26(19-23)30(38)29(41-28)18-22-21-37(17-16-36-14-12-35(3)13-15-36)27-8-7-24(40-4)20-25(22)27/h6-9,18-21H,5,10-17H2,1-4H3,(H2,32,33,39)/b29-18- |
| InChIKey | CQAWOYOPSCVVFM-MIXAMLLLSA-N |
| XLogP | 3.59 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|