About 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid
5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid (PubChem CID 69003794) has the molecular formula C21H20FNO2S
and a molecular weight of 369.46 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid |
| PubChem CID | 69003794 |
| Molecular Formula | C21H20FNO2S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid |
| SMILES | CC(c1ccc(F)cc1)C(CC(C(=O)O)c1nccs1)c1ccccc1 |
| InChI | InChI=1S/C21H20FNO2S/c1-14(15-7-9-17(22)10-8-15)18(16-5-3-2-4-6-16)13-19(21(24)25)20-23-11-12-26-20/h2-12,14,18-19H,13H2,1H3,(H,24,25) |
| InChIKey | BHQQHTALDAFAQD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
The IUPAC name of 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid (CID 69003794) is 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid.
What is the SMILES notation for 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
The canonical SMILES for 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid is CC(c1ccc(F)cc1)C(CC(C(=O)O)c1nccs1)c1ccccc1.
What is the InChIKey of 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
The InChIKey is BHQQHTALDAFAQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FNO2S/c1-14(15-7-9-17(22)10-8-15)18(16-5-3-2-4-6-16)13-19(21(24)25)20-23-11-12-26-20/h2-12,14,18-19H,13H2,1H3,(H,24,25).
What are the key properties of 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid has a molecular weight of 369.46 g/mol, XLogP of 5.43, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid is sourced from PubChem (CID 69003794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).