C23H17Cl2N2O2P — CID 6900408
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (PubChem CID 6900408) has the molecular formula C23H17Cl2N2O2P and a molecular weight of 455.28 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
|---|---|
| PubChem CID | 6900408 |
| Molecular Formula | C23H17Cl2N2O2P |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| SMILES | O=P1(N/N=C/c2ccc(Cl)cc2Cl)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C23H17Cl2N2O2P/c24-20-12-11-19(21(25)13-20)14-26-27-30(28)15-22(17-7-3-1-4-8-17)29-23(16-30)18-9-5-2-6-10-18/h1-16H,(H,27,28)/b26-14+ |
| InChIKey | CDGIMHJFSQYGQF-VULFUBBASA-N |
| XLogP | 7.22 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|