C18H41NO4Si2 — CID 69004089
N,N-bis[[diethoxy(methyl)silyl]methyl]cyclohexanamine (PubChem CID 69004089) has the molecular formula C18H41NO4Si2 and a molecular weight of 391.70 g/mol. Its IUPAC name is N,N-bis[[diethoxy(methyl)silyl]methyl]cyclohexanamine.
| Compound Name | N,N-bis[[diethoxy(methyl)silyl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 69004089 |
| Molecular Formula | C18H41NO4Si2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N,N-bis[[diethoxy(methyl)silyl]methyl]cyclohexanamine |
| SMILES | CCO[Si](C)(CN(C[Si](C)(OCC)OCC)C1CCCCC1)OCC |
| InChI | InChI=1S/C18H41NO4Si2/c1-7-20-24(5,21-8-2)16-19(18-14-12-11-13-15-18)17-25(6,22-9-3)23-10-4/h18H,7-17H2,1-6H3 |
| InChIKey | NLCGNCWUZCFTDX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|