About (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one
(2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (PubChem CID 69004476) has the molecular formula C27H17NO4
and a molecular weight of 419.44 g/mol. Its IUPAC name is (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| PubChem CID | 69004476 |
| Molecular Formula | C27H17NO4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2c(-c3ccc4ccccc4c3)[nH]c3ccccc23)Oc2c1ccc(O)c2O |
| InChI | InChI=1S/C27H17NO4/c29-22-12-11-19-25(30)23(32-27(19)26(22)31)14-20-18-7-3-4-8-21(18)28-24(20)17-10-9-15-5-1-2-6-16(15)13-17/h1-14,28-29,31H/b23-14- |
| InChIKey | STNPRPFIGWVYEU-UCQKPKSFSA-N |
| XLogP | 6.02 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The IUPAC name of (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one (CID 69004476) is (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one.
What is the SMILES notation for (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The canonical SMILES for (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one is O=C1/C(=C/c2c(-c3ccc4ccccc4c3)[nH]c3ccccc23)Oc2c1ccc(O)c2O.
What is the InChIKey of (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
The InChIKey is STNPRPFIGWVYEU-UCQKPKSFSA-N. The full InChI is InChI=1S/C27H17NO4/c29-22-12-11-19-25(30)23(32-27(19)26(22)31)14-20-18-7-3-4-8-21(18)28-24(20)17-10-9-15-5-1-2-6-16(15)13-17/h1-14,28-29,31H/b23-14-.
What are the key properties of (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one?
(2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one has a molecular weight of 419.44 g/mol, XLogP of 6.02, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-6,7-dihydroxy-2-[(2-naphthalen-2-yl-1H-indol-3-yl)methylidene]-1-benzofuran-3-one is sourced from PubChem (CID 69004476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).