C12H11F3N4 — CID 6900463
(E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[2-(trifluoromethyl)phenyl]methanimine (PubChem CID 6900463) has the molecular formula C12H11F3N4 and a molecular weight of 268.24 g/mol. Its IUPAC name is (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[2-(trifluoromethyl)phenyl]methanimine.
| Compound Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[2-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 6900463 |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (E)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-[2-(trifluoromethyl)phenyl]methanimine |
| SMILES | Cc1nnc(C)n1/N=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N4/c1-8-17-18-9(2)19(8)16-7-10-5-3-4-6-11(10)12(13,14)15/h3-7H,1-2H3/b16-7+ |
| InChIKey | ZOTRHZKBKDREBL-FRKPEAEDSA-N |
| XLogP | 2.80 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|