C22H25N5O2 — CID 6900472
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(2-propoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6900472) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(2-propoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(2-propoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6900472 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(2-propoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCOc1ccccc1-c1cc(C(=O)N/N=C/c2ccc(N(C)C)cc2)[nH]n1 |
| InChI | InChI=1S/C22H25N5O2/c1-4-13-29-21-8-6-5-7-18(21)19-14-20(25-24-19)22(28)26-23-15-16-9-11-17(12-10-16)27(2)3/h5-12,14-15H,4,13H2,1-3H3,(H,24,25)(H,26,28)/b23-15+ |
| InChIKey | CZHDWTGQIMDEQO-HZHRSRAPSA-N |
| XLogP | 3.70 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|