About [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid
[4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid (PubChem CID 69005124) has the molecular formula C9H17NO5
and a molecular weight of 219.24 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid |
| PubChem CID | 69005124 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid |
| SMILES | CC1(C)OCC(CNC(=O)O)C(CO)O1 |
| InChI | InChI=1S/C9H17NO5/c1-9(2)14-5-6(3-10-8(12)13)7(4-11)15-9/h6-7,10-11H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | BKTLLEYTCZKBDX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid?
The IUPAC name of [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid (CID 69005124) is [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid.
What is the SMILES notation for [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid?
The canonical SMILES for [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid is CC1(C)OCC(CNC(=O)O)C(CO)O1.
What is the InChIKey of [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid?
The InChIKey is BKTLLEYTCZKBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO5/c1-9(2)14-5-6(3-10-8(12)13)7(4-11)15-9/h6-7,10-11H,3-5H2,1-2H3,(H,12,13).
What are the key properties of [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid?
[4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid has a molecular weight of 219.24 g/mol, XLogP of 0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methylcarbamic acid is sourced from PubChem (CID 69005124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).