About N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine
N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine (PubChem CID 69005155) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine |
| PubChem CID | 69005155 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine |
| SMILES | C=C1C=CC=CC1N(CC)CC |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-9-7-6-8-10(11)3/h6-9,11H,3-5H2,1-2H3 |
| InChIKey | JELQDTUXEIRMLD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine?
The IUPAC name of N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine (CID 69005155) is N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine?
The canonical SMILES for N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine is C=C1C=CC=CC1N(CC)CC.
What is the InChIKey of N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine?
The InChIKey is JELQDTUXEIRMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-4-12(5-2)11-9-7-6-8-10(11)3/h6-9,11H,3-5H2,1-2H3.
What are the key properties of N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine?
N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine has a molecular weight of 163.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-6-methylidenecyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 69005155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).