About 8H-indolizino[1,2-b]quinolin-9-one
8H-indolizino[1,2-b]quinolin-9-one (PubChem CID 69005158) has the molecular formula C15H10N2O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 8H-indolizino[1,2-b]quinolin-9-one.
Molecular Properties
| Compound Name | 8H-indolizino[1,2-b]quinolin-9-one |
| PubChem CID | 69005158 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 8H-indolizino[1,2-b]quinolin-9-one |
| SMILES | O=C1CC=Cc2c3nc4ccccc4cc3cn21 |
| InChI | InChI=1S/C15H10N2O/c18-14-7-3-6-13-15-11(9-17(13)14)8-10-4-1-2-5-12(10)16-15/h1-6,8-9H,7H2 |
| InChIKey | LZAYPIAXAAIICQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8H-indolizino[1,2-b]quinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-indolizino[1,2-b]quinolin-9-one?
The IUPAC name of 8H-indolizino[1,2-b]quinolin-9-one (CID 69005158) is 8H-indolizino[1,2-b]quinolin-9-one.
What is the SMILES notation for 8H-indolizino[1,2-b]quinolin-9-one?
The canonical SMILES for 8H-indolizino[1,2-b]quinolin-9-one is O=C1CC=Cc2c3nc4ccccc4cc3cn21.
What is the InChIKey of 8H-indolizino[1,2-b]quinolin-9-one?
The InChIKey is LZAYPIAXAAIICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O/c18-14-7-3-6-13-15-11(9-17(13)14)8-10-4-1-2-5-12(10)16-15/h1-6,8-9H,7H2.
What are the key properties of 8H-indolizino[1,2-b]quinolin-9-one?
8H-indolizino[1,2-b]quinolin-9-one has a molecular weight of 234.26 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-indolizino[1,2-b]quinolin-9-one is sourced from PubChem (CID 69005158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).