About 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol
3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol (PubChem CID 69005184) has the molecular formula C21H23N3O
and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol.
Molecular Properties
| Compound Name | 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol |
| PubChem CID | 69005184 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol |
| SMILES | Cc1cc(C)c2nc(C3CC3)n(Cc3ccc(C=CCO)cc3)c2n1 |
| InChI | InChI=1S/C21H23N3O/c1-14-12-15(2)22-21-19(14)23-20(18-9-10-18)24(21)13-17-7-5-16(6-8-17)4-3-11-25/h3-8,12,18,25H,9-11,13H2,1-2H3 |
| InChIKey | XJWUYUOAJDKDJA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol?
The IUPAC name of 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol (CID 69005184) is 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol.
What is the SMILES notation for 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol?
The canonical SMILES for 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol is Cc1cc(C)c2nc(C3CC3)n(Cc3ccc(C=CCO)cc3)c2n1.
What is the InChIKey of 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol?
The InChIKey is XJWUYUOAJDKDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O/c1-14-12-15(2)22-21-19(14)23-20(18-9-10-18)24(21)13-17-7-5-16(6-8-17)4-3-11-25/h3-8,12,18,25H,9-11,13H2,1-2H3.
What are the key properties of 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol?
3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol has a molecular weight of 333.44 g/mol, XLogP of 3.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2-cyclopropyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]prop-2-en-1-ol is sourced from PubChem (CID 69005184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).