C12H10F3NO3 — CID 69005291
(6S)-6-methyl-4-[(3,4,5-trifluorophenyl)methyl]morpholine-2,3-dione (PubChem CID 69005291) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is (6S)-6-methyl-4-[(3,4,5-trifluorophenyl)methyl]morpholine-2,3-dione.
| Compound Name | (6S)-6-methyl-4-[(3,4,5-trifluorophenyl)methyl]morpholine-2,3-dione |
|---|---|
| PubChem CID | 69005291 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (6S)-6-methyl-4-[(3,4,5-trifluorophenyl)methyl]morpholine-2,3-dione |
| SMILES | C[C@H]1CN(Cc2cc(F)c(F)c(F)c2)C(=O)C(=O)O1 |
| InChI | InChI=1S/C12H10F3NO3/c1-6-4-16(11(17)12(18)19-6)5-7-2-8(13)10(15)9(14)3-7/h2-3,6H,4-5H2,1H3/t6-/m0/s1 |
| InChIKey | VLYDASXGZCVEAJ-LURJTMIESA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|