C18H22F3NO5 — CID 69005366
(2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(3,4,5-trifluorophenyl)hexanoic acid (PubChem CID 69005366) has the molecular formula C18H22F3NO5 and a molecular weight of 389.37 g/mol. Its IUPAC name is (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(3,4,5-trifluorophenyl)hexanoic acid.
| Compound Name | (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(3,4,5-trifluorophenyl)hexanoic acid |
|---|---|
| PubChem CID | 69005366 |
| Molecular Formula | C18H22F3NO5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(3,4,5-trifluorophenyl)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(CCCC(=O)c1cc(F)c(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C18H22F3NO5/c1-17(2,3)27-16(26)22-18(4,15(24)25)7-5-6-13(23)10-8-11(19)14(21)12(20)9-10/h8-9H,5-7H2,1-4H3,(H,22,26)(H,24,25)/t18-/m1/s1 |
| InChIKey | CBHFSVALYJPDEU-GOSISDBHSA-N |
| XLogP | 3.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|