About bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate
bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (PubChem CID 69005566) has the molecular formula C20H28O4
and a molecular weight of 332.44 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| PubChem CID | 69005566 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| SMILES | CCCCOC(=O)C1=CC2CCC1C2.O=C(O)C1=CC2CCC1C2 |
| InChI | InChI=1S/C12H18O2.C8H10O2/c1-2-3-6-14-12(13)11-8-9-4-5-10(11)7-9;9-8(10)7-4-5-1-2-6(7)3-5/h8-10H,2-7H2,1H3;4-6H,1-3H2,(H,9,10) |
| InChIKey | UUVRBUVSDBJWLS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The IUPAC name of bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (CID 69005566) is bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate is CCCCOC(=O)C1=CC2CCC1C2.O=C(O)C1=CC2CCC1C2.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The InChIKey is UUVRBUVSDBJWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2.C8H10O2/c1-2-3-6-14-12(13)11-8-9-4-5-10(11)7-9;9-8(10)7-4-5-1-2-6(7)3-5/h8-10H,2-7H2,1H3;4-6H,1-3H2,(H,9,10).
What are the key properties of bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate has a molecular weight of 332.44 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene-2-carboxylic acid;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate is sourced from PubChem (CID 69005566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).