C19H26N2O5S2 — CID 69006013
2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)benzamide (PubChem CID 69006013) has the molecular formula C19H26N2O5S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)benzamide.
| Compound Name | 2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)benzamide |
|---|---|
| PubChem CID | 69006013 |
| Molecular Formula | C19H26N2O5S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-(4,4-dimethylcyclohexen-1-yl)-4-(2-methyl-1,1,3,3-tetraoxo-1,3,2-dithiazinan-5-yl)benzamide |
| SMILES | CN1S(=O)(=O)CC(c2ccc(C(N)=O)c(C3=CCC(C)(C)CC3)c2)CS1(=O)=O |
| InChI | InChI=1S/C19H26N2O5S2/c1-19(2)8-6-13(7-9-19)17-10-14(4-5-16(17)18(20)22)15-11-27(23,24)21(3)28(25,26)12-15/h4-6,10,15H,7-9,11-12H2,1-3H3,(H2,20,22) |
| InChIKey | RMDBTLGUAUVBPT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |