C14H24N4O9 — CID 69006798
(E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]guanidine (PubChem CID 69006798) has the molecular formula C14H24N4O9 and a molecular weight of 392.37 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]guanidine.
| Compound Name | (E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 69006798 |
| Molecular Formula | C14H24N4O9 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (E)-but-2-enedioic acid;1-methyl-1-[2-oxo-2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]guanidine |
| SMILES | O=C(O)/C=C/C(=O)O.[H]/N=C(\N)N(C)CC(=O)N1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C10H20N4O5.C4H4O4/c1-13(10(11)12)3-7(17)14-2-6(16)9(19)8(18)5(14)4-15;5-3(6)1-2-4(7)8/h5-6,8-9,15-16,18-19H,2-4H2,1H3,(H3,11,12);1-2H,(H,5,6)(H,7,8)/b;2-1+/t5-,6+,8-,9-;/m1./s1 |
| InChIKey | ROPBOBDLPOXKJH-DBJXCREHSA-N |
| XLogP | -4.19 |
| TPSA | 228.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|