C33H46N2O4 — CID 69006898
N,N'-bis[(1R)-1-(1-hydroxycyclohexyl)-2-phenylethyl]-2,2-dimethylpropanediamide (PubChem CID 69006898) has the molecular formula C33H46N2O4 and a molecular weight of 534.74 g/mol. Its IUPAC name is N,N'-bis[(1R)-1-(1-hydroxycyclohexyl)-2-phenylethyl]-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis[(1R)-1-(1-hydroxycyclohexyl)-2-phenylethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 69006898 |
| Molecular Formula | C33H46N2O4 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | N,N'-bis[(1R)-1-(1-hydroxycyclohexyl)-2-phenylethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)N[C@H](Cc1ccccc1)C1(O)CCCCC1)C(=O)N[C@H](Cc1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C33H46N2O4/c1-31(2,29(36)34-27(23-25-15-7-3-8-16-25)32(38)19-11-5-12-20-32)30(37)35-28(24-26-17-9-4-10-18-26)33(39)21-13-6-14-22-33/h3-4,7-10,15-18,27-28,38-39H,5-6,11-14,19-24H2,1-2H3,(H,34,36)(H,35,37)/t27-,28-/m1/s1 |
| InChIKey | LPCICDBAVMHSTC-VSGBNLITSA-N |
| XLogP | 4.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|