C20H24N6O3 — CID 69007295
N-ethyl-4-(oxan-4-ylamino)-N-[(1-oxidopyridin-1-ium-3-yl)methyl]-1H-pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 69007295) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-ethyl-4-(oxan-4-ylamino)-N-[(1-oxidopyridin-1-ium-3-yl)methyl]-1H-pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-ethyl-4-(oxan-4-ylamino)-N-[(1-oxidopyridin-1-ium-3-yl)methyl]-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 69007295 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-ethyl-4-(oxan-4-ylamino)-N-[(1-oxidopyridin-1-ium-3-yl)methyl]-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCN(Cc1ccc[n+]([O-])c1)C(=O)c1cnc2[nH]ncc2c1NC1CCOCC1 |
| InChI | InChI=1S/C20H24N6O3/c1-2-25(12-14-4-3-7-26(28)13-14)20(27)17-10-21-19-16(11-22-24-19)18(17)23-15-5-8-29-9-6-15/h3-4,7,10-11,13,15H,2,5-6,8-9,12H2,1H3,(H2,21,22,23,24) |
| InChIKey | GRNZXLNILQSJNQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|