About 2,5-bis(2,4-dimethylphenyl)furan
2,5-bis(2,4-dimethylphenyl)furan (PubChem CID 69007867) has the molecular formula C20H20O
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,5-bis(2,4-dimethylphenyl)furan.
Molecular Properties
| Compound Name | 2,5-bis(2,4-dimethylphenyl)furan |
| PubChem CID | 69007867 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2,5-bis(2,4-dimethylphenyl)furan |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)cc3C)o2)c(C)c1 |
| InChI | InChI=1S/C20H20O/c1-13-5-7-17(15(3)11-13)19-9-10-20(21-19)18-8-6-14(2)12-16(18)4/h5-12H,1-4H3 |
| InChIKey | BVGWUHYSHSSVLA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-bis(2,4-dimethylphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2,4-dimethylphenyl)furan?
The IUPAC name of 2,5-bis(2,4-dimethylphenyl)furan (CID 69007867) is 2,5-bis(2,4-dimethylphenyl)furan.
What is the SMILES notation for 2,5-bis(2,4-dimethylphenyl)furan?
The canonical SMILES for 2,5-bis(2,4-dimethylphenyl)furan is Cc1ccc(-c2ccc(-c3ccc(C)cc3C)o2)c(C)c1.
What is the InChIKey of 2,5-bis(2,4-dimethylphenyl)furan?
The InChIKey is BVGWUHYSHSSVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O/c1-13-5-7-17(15(3)11-13)19-9-10-20(21-19)18-8-6-14(2)12-16(18)4/h5-12H,1-4H3.
What are the key properties of 2,5-bis(2,4-dimethylphenyl)furan?
2,5-bis(2,4-dimethylphenyl)furan has a molecular weight of 276.38 g/mol, XLogP of 5.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2,4-dimethylphenyl)furan is sourced from PubChem (CID 69007867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).