C15H23FN2O2 — CID 69009268
1-(3-fluoro-2-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 69009268) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-(3-fluoro-2-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-(3-fluoro-2-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 69009268 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(3-fluoro-2-hydroxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)Nc1cccc(F)c1O |
| InChI | InChI=1S/C15H23FN2O2/c1-14(2,3)9-15(4,5)18-13(20)17-11-8-6-7-10(16)12(11)19/h6-8,19H,9H2,1-5H3,(H2,17,18,20) |
| InChIKey | JEUVXCLPKPQKLO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|