About cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone
cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone (PubChem CID 69009468) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone |
| PubChem CID | 69009468 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone |
| SMILES | O=C(c1ccc2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C11H10N2O/c14-10(7-1-2-7)9-4-3-8-5-6-12-11(8)13-9/h3-7H,1-2H2,(H,12,13) |
| InChIKey | UVZDNZTUTSUDFB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone?
The IUPAC name of cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone (CID 69009468) is cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone.
What is the SMILES notation for cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone?
The canonical SMILES for cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone is O=C(c1ccc2cc[nH]c2n1)C1CC1.
What is the InChIKey of cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone?
The InChIKey is UVZDNZTUTSUDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c14-10(7-1-2-7)9-4-3-8-5-6-12-11(8)13-9/h3-7H,1-2H2,(H,12,13).
What are the key properties of cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone?
cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone has a molecular weight of 186.21 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl(1H-pyrrolo[2,3-b]pyridin-6-yl)methanone is sourced from PubChem (CID 69009468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).