C14H11F2NO3 — CID 69009504
(6S)-6-(3,4-difluorophenyl)-1,6,7,8-tetrahydropyrido[2,1-c][1,4]oxazine-3,4-dione (PubChem CID 69009504) has the molecular formula C14H11F2NO3 and a molecular weight of 279.24 g/mol. Its IUPAC name is (6S)-6-(3,4-difluorophenyl)-1,6,7,8-tetrahydropyrido[2,1-c][1,4]oxazine-3,4-dione.
| Compound Name | (6S)-6-(3,4-difluorophenyl)-1,6,7,8-tetrahydropyrido[2,1-c][1,4]oxazine-3,4-dione |
|---|---|
| PubChem CID | 69009504 |
| Molecular Formula | C14H11F2NO3 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (6S)-6-(3,4-difluorophenyl)-1,6,7,8-tetrahydropyrido[2,1-c][1,4]oxazine-3,4-dione |
| SMILES | O=C1OCC2=CCC[C@@H](c3ccc(F)c(F)c3)N2C1=O |
| InChI | InChI=1S/C14H11F2NO3/c15-10-5-4-8(6-11(10)16)12-3-1-2-9-7-20-14(19)13(18)17(9)12/h2,4-6,12H,1,3,7H2/t12-/m0/s1 |
| InChIKey | JQSOZMVVDIKCED-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|