About (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine
(4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine (PubChem CID 69009771) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine.
Molecular Properties
| Compound Name | (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine |
| PubChem CID | 69009771 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine |
| SMILES | CCCCO/C=C1/C=CC(N)=CC1N |
| InChI | InChI=1S/C11H18N2O/c1-2-3-6-14-8-9-4-5-10(12)7-11(9)13/h4-5,7-8,11H,2-3,6,12-13H2,1H3/b9-8- |
| InChIKey | DFRKHUNLYWWDBF-HJWRWDBZSA-N |
| XLogP | 1.43 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine?
The IUPAC name of (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine (CID 69009771) is (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine.
What is the SMILES notation for (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine?
The canonical SMILES for (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine is CCCCO/C=C1/C=CC(N)=CC1N.
What is the InChIKey of (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine?
The InChIKey is DFRKHUNLYWWDBF-HJWRWDBZSA-N. The full InChI is InChI=1S/C11H18N2O/c1-2-3-6-14-8-9-4-5-10(12)7-11(9)13/h4-5,7-8,11H,2-3,6,12-13H2,1H3/b9-8-.
What are the key properties of (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine?
(4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine has a molecular weight of 194.28 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(butoxymethylidene)cyclohexa-1,5-diene-1,3-diamine is sourced from PubChem (CID 69009771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).