C31H31N3O2 — CID 6901085
2-(4-tert-butylphenoxy)-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]acetamide (PubChem CID 6901085) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6901085 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N/N=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H31N3O2/c1-31(2,3)25-16-20-29(21-17-25)36-23-30(35)33-32-22-24-14-18-28(19-15-24)34(26-10-6-4-7-11-26)27-12-8-5-9-13-27/h4-22H,23H2,1-3H3,(H,33,35)/b32-22+ |
| InChIKey | GJQOYAWGJQQXCK-WEMUVCOSSA-N |
| XLogP | 6.98 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|