About 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol
4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol (PubChem CID 69010914) has the molecular formula C20H17Cl2NO2S
and a molecular weight of 406.33 g/mol. Its IUPAC name is 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol.
Molecular Properties
| Compound Name | 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol |
| PubChem CID | 69010914 |
| Molecular Formula | C20H17Cl2NO2S |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc(NCc2ccccc2Sc2ccc(Cl)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C20H17Cl2NO2S/c21-17-7-6-16(10-18(17)22)26-20-4-2-1-3-13(20)11-23-15-5-8-19(25)14(9-15)12-24/h1-10,23-25H,11-12H2 |
| InChIKey | APSOSKDPBQCRTI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol?
The IUPAC name of 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol (CID 69010914) is 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol.
What is the SMILES notation for 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol?
The canonical SMILES for 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol is OCc1cc(NCc2ccccc2Sc2ccc(Cl)c(Cl)c2)ccc1O.
What is the InChIKey of 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol?
The InChIKey is APSOSKDPBQCRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Cl2NO2S/c21-17-7-6-16(10-18(17)22)26-20-4-2-1-3-13(20)11-23-15-5-8-19(25)14(9-15)12-24/h1-10,23-25H,11-12H2.
What are the key properties of 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol?
4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol has a molecular weight of 406.33 g/mol, XLogP of 5.95, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,4-dichlorophenyl)sulfanylphenyl]methylamino]-2-(hydroxymethyl)phenol is sourced from PubChem (CID 69010914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).