About 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride
1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride (PubChem CID 69011048) has the molecular formula C9H17ClN2O
and a molecular weight of 204.70 g/mol. Its IUPAC name is 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride.
Molecular Properties
| Compound Name | 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride |
| PubChem CID | 69011048 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride |
| SMILES | CC12CNCC(C)(CNC1)C2=O.Cl |
| InChI | InChI=1S/C9H16N2O.ClH/c1-8-3-10-5-9(2,7(8)12)6-11-4-8;/h10-11H,3-6H2,1-2H3;1H |
| InChIKey | KTEDIHLKZFUABZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride?
The IUPAC name of 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride (CID 69011048) is 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride.
What is the SMILES notation for 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride?
The canonical SMILES for 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride is CC12CNCC(C)(CNC1)C2=O.Cl.
What is the InChIKey of 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride?
The InChIKey is KTEDIHLKZFUABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O.ClH/c1-8-3-10-5-9(2,7(8)12)6-11-4-8;/h10-11H,3-6H2,1-2H3;1H.
What are the key properties of 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride?
1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride has a molecular weight of 204.70 g/mol, XLogP of 0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one;hydrochloride is sourced from PubChem (CID 69011048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).