C11H16O6 — CID 69011172
(1R,3S,5R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylic acid (PubChem CID 69011172) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is (1R,3S,5R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylic acid.
| Compound Name | (1R,3S,5R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylic acid |
|---|---|
| PubChem CID | 69011172 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (1R,3S,5R,6R,7S)-6-hydroxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylic acid |
| SMILES | CC1(C)OC[C@H]2O[C@@H]3C(C(=O)O)[C@@H]3[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C11H16O6/c1-11(2)15-3-4-8(17-11)7(12)5-6(10(13)14)9(5)16-4/h4-9,12H,3H2,1-2H3,(H,13,14)/t4-,5-,6?,7-,8-,9+/m1/s1 |
| InChIKey | RODROGCCKSUBRA-IWQRPMHPSA-N |
| XLogP | -0.40 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |