About 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole
2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 69011749) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole.
Analyze 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole?
The IUPAC name of 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole (CID 69011749) is 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole.
What is the SMILES notation for 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole?
The canonical SMILES for 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole is CC1(C)OC2=CNCC2O1.
What is the InChIKey of 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole?
The InChIKey is ZQKNRZRBVXTNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-7(2)9-5-3-8-4-6(5)10-7/h3,6,8H,4H2,1-2H3.
What are the key properties of 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole?
2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole has a molecular weight of 141.17 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-c]pyrrole is sourced from PubChem (CID 69011749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).