About 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide
4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide (PubChem CID 69014036) has the molecular formula C9H8BrCl2N3O2
and a molecular weight of 340.99 g/mol. Its IUPAC name is 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide |
| PubChem CID | 69014036 |
| Molecular Formula | C9H8BrCl2N3O2 |
| Molecular Weight | 340.99 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide |
| SMILES | NC(=O)c1nc(C(N)=O)c(CCl)c(Br)c1CCl |
| InChI | InChI=1S/C9H8BrCl2N3O2/c10-5-3(1-11)6(8(13)16)15-7(9(14)17)4(5)2-12/h1-2H2,(H2,13,16)(H2,14,17) |
| InChIKey | DYZOZFKLKUKBNC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.99 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide?
The IUPAC name of 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide (CID 69014036) is 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide.
What is the SMILES notation for 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide?
The canonical SMILES for 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide is NC(=O)c1nc(C(N)=O)c(CCl)c(Br)c1CCl.
What is the InChIKey of 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide?
The InChIKey is DYZOZFKLKUKBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrCl2N3O2/c10-5-3(1-11)6(8(13)16)15-7(9(14)17)4(5)2-12/h1-2H2,(H2,13,16)(H2,14,17).
What are the key properties of 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide?
4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide has a molecular weight of 340.99 g/mol, XLogP of 1.52, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-bis(chloromethyl)pyridine-2,6-dicarboxamide is sourced from PubChem (CID 69014036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).